ChemNet > CAS > 833-48-7 10,11-Dihydro-5H-dibenzo[a,d]cycloheptene
833-48-7 10,11-Dihydro-5H-dibenzo[a,d]cycloheptene
Naam product |
10,11-Dihydro-5H-dibenzo[a,d]cycloheptene |
Engelse naam |
10,11-Dihydro-5H-dibenzo[a,d]cycloheptene; Dibenzosuberane; 10,11-dihydro-5H-dibenzo[a,d][7]annulene |
MF |
C15H14 |
Molecuulgewicht |
194.2717 |
InChI |
InChI=1/C15H14/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-8H,9-11H2 |
CAS-nummer |
833-48-7 |
EINECS |
212-630-5 |
Moleculaire Structuur |
|
Dichtheid |
1.056g/cm3 |
Smeltpunt |
72-76℃ |
Kookpunt |
356.7°C at 760 mmHg |
Brekingsindex |
1.601 |
Vlampunt |
135.1°C |
Dampdruk |
5.89E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|